C12H19NO — CID 82075858
2-(3,4-dimethylphenoxy)-N,N-dimethylethanamine (PubChem CID 82075858) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 2-(3,4-dimethylphenoxy)-N,N-dimethylethanamine.
| Compound Name | 2-(3,4-dimethylphenoxy)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 82075858 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 2-(3,4-dimethylphenoxy)-N,N-dimethylethanamine |
| SMILES | Cc1ccc(OCCN(C)C)cc1C |
| InChI | InChI=1S/C12H19NO/c1-10-5-6-12(9-11(10)2)14-8-7-13(3)4/h5-6,9H,7-8H2,1-4H3 |
| InChIKey | NZJOZGWGZPWZSK-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |