C13H21NO — CID 163472505
2-(4-ethyl-3-methylphenoxy)-N,N-dimethylethanamine (PubChem CID 163472505) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is 2-(4-ethyl-3-methylphenoxy)-N,N-dimethylethanamine.
| Compound Name | 2-(4-ethyl-3-methylphenoxy)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 163472505 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 2-(4-ethyl-3-methylphenoxy)-N,N-dimethylethanamine |
| SMILES | CCc1ccc(OCCN(C)C)cc1C |
| InChI | InChI=1S/C13H21NO/c1-5-12-6-7-13(10-11(12)2)15-9-8-14(3)4/h6-7,10H,5,8-9H2,1-4H3 |
| InChIKey | BXRIEERPTZBSIG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |