C14H23NO — CID 170866578
3-(4-ethoxy-2-methylphenyl)-N,N-dimethylpropan-1-amine (PubChem CID 170866578) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 3-(4-ethoxy-2-methylphenyl)-N,N-dimethylpropan-1-amine.
| Compound Name | 3-(4-ethoxy-2-methylphenyl)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 170866578 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 3-(4-ethoxy-2-methylphenyl)-N,N-dimethylpropan-1-amine |
| SMILES | CCOc1ccc(CCCN(C)C)c(C)c1 |
| InChI | InChI=1S/C14H23NO/c1-5-16-14-9-8-13(12(2)11-14)7-6-10-15(3)4/h8-9,11H,5-7,10H2,1-4H3 |
| InChIKey | ILENXWGQANFPRJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |