C23H37N5O — CID 142789375
5-[6-[4-[3-(dimethylamino)propoxy]-2-methylphenyl]hexyl]-6-methylpyrimidine-2,4-diamine (PubChem CID 142789375) has the molecular formula C23H37N5O and a molecular weight of 399.58 g/mol. Its IUPAC name is 5-[6-[4-[3-(dimethylamino)propoxy]-2-methylphenyl]hexyl]-6-methylpyrimidine-2,4-diamine.
| Compound Name | 5-[6-[4-[3-(dimethylamino)propoxy]-2-methylphenyl]hexyl]-6-methylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 142789375 |
| Molecular Formula | C23H37N5O |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.30 |
| IUPAC Name | 5-[6-[4-[3-(dimethylamino)propoxy]-2-methylphenyl]hexyl]-6-methylpyrimidine-2,4-diamine |
| SMILES | Cc1cc(OCCCN(C)C)ccc1CCCCCCc1c(C)nc(N)nc1N |
| InChI | InChI=1S/C23H37N5O/c1-17-16-20(29-15-9-14-28(3)4)13-12-19(17)10-7-5-6-8-11-21-18(2)26-23(25)27-22(21)24/h12-13,16H,5-11,14-15H2,1-4H3,(H4,24,25,26,27) |
| InChIKey | NGJCAYCVDDVOOW-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|