C12H19FN2O — CID 114524601
3-[4-(aminomethyl)-3-fluorophenoxy]-N,N-dimethylpropan-1-amine (PubChem CID 114524601) has the molecular formula C12H19FN2O and a molecular weight of 226.29 g/mol. Its IUPAC name is 3-[4-(aminomethyl)-3-fluorophenoxy]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[4-(aminomethyl)-3-fluorophenoxy]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 114524601 |
| Molecular Formula | C12H19FN2O |
| Molecular Weight | 226.29 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 3-[4-(aminomethyl)-3-fluorophenoxy]-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCOc1ccc(CN)c(F)c1 |
| InChI | InChI=1S/C12H19FN2O/c1-15(2)6-3-7-16-11-5-4-10(9-14)12(13)8-11/h4-5,8H,3,6-7,9,14H2,1-2H3 |
| InChIKey | XLXVWQCYDZBXPB-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.29 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|