C15H25NO2 — CID 2993413
3-(3-butoxyphenoxy)-N,N-dimethylpropan-1-amine (PubChem CID 2993413) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 3-(3-butoxyphenoxy)-N,N-dimethylpropan-1-amine.
| Compound Name | 3-(3-butoxyphenoxy)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 2993413 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 3-(3-butoxyphenoxy)-N,N-dimethylpropan-1-amine |
| SMILES | CCCCOc1cccc(OCCCN(C)C)c1 |
| InChI | InChI=1S/C15H25NO2/c1-4-5-11-17-14-8-6-9-15(13-14)18-12-7-10-16(2)3/h6,8-9,13H,4-5,7,10-12H2,1-3H3 |
| InChIKey | HDPADCMJCYPDMW-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|