C23H33NO2 — CID 139784207
3-[4-butoxy-2-(2-phenylethyl)phenoxy]-N,N-dimethylpropan-1-amine (PubChem CID 139784207) has the molecular formula C23H33NO2 and a molecular weight of 355.52 g/mol. Its IUPAC name is 3-[4-butoxy-2-(2-phenylethyl)phenoxy]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[4-butoxy-2-(2-phenylethyl)phenoxy]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 139784207 |
| Molecular Formula | C23H33NO2 |
| Molecular Weight | 355.52 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | 3-[4-butoxy-2-(2-phenylethyl)phenoxy]-N,N-dimethylpropan-1-amine |
| SMILES | CCCCOc1ccc(OCCCN(C)C)c(CCc2ccccc2)c1 |
| InChI | InChI=1S/C23H33NO2/c1-4-5-17-25-22-14-15-23(26-18-9-16-24(2)3)21(19-22)13-12-20-10-7-6-8-11-20/h6-8,10-11,14-15,19H,4-5,9,12-13,16-18H2,1-3H3 |
| InChIKey | QOAPFDBCMVDSOJ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.52 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|