C21H29NO3 — CID 139784170
3-[4-(methoxymethoxy)-2-(2-phenylethyl)phenoxy]-N,N-dimethylpropan-1-amine (PubChem CID 139784170) has the molecular formula C21H29NO3 and a molecular weight of 343.47 g/mol. Its IUPAC name is 3-[4-(methoxymethoxy)-2-(2-phenylethyl)phenoxy]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[4-(methoxymethoxy)-2-(2-phenylethyl)phenoxy]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 139784170 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 3-[4-(methoxymethoxy)-2-(2-phenylethyl)phenoxy]-N,N-dimethylpropan-1-amine |
| SMILES | COCOc1ccc(OCCCN(C)C)c(CCc2ccccc2)c1 |
| InChI | InChI=1S/C21H29NO3/c1-22(2)14-7-15-24-21-13-12-20(25-17-23-3)16-19(21)11-10-18-8-5-4-6-9-18/h4-6,8-9,12-13,16H,7,10-11,14-15,17H2,1-3H3 |
| InChIKey | SHTPYRDJQSLZOZ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|