C27H33NO5 — CID 134285054
2-hydroxybenzoic acid;3-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]-N,N-dimethylpropan-1-amine (PubChem CID 134285054) has the molecular formula C27H33NO5 and a molecular weight of 451.56 g/mol. Its IUPAC name is 2-hydroxybenzoic acid;3-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]-N,N-dimethylpropan-1-amine.
| Compound Name | 2-hydroxybenzoic acid;3-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 134285054 |
| Molecular Formula | C27H33NO5 |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | 2-hydroxybenzoic acid;3-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]-N,N-dimethylpropan-1-amine |
| SMILES | COc1cccc(CCc2ccccc2OCCCN(C)C)c1.O=C(O)c1ccccc1O |
| InChI | InChI=1S/C20H27NO2.C7H6O3/c1-21(2)14-7-15-23-20-11-5-4-9-18(20)13-12-17-8-6-10-19(16-17)22-3;8-6-4-2-1-3-5(6)7(9)10/h4-6,8-11,16H,7,12-15H2,1-3H3;1-4,8H,(H,9,10) |
| InChIKey | WPTCZSSKBWKPOT-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|