C14H21NO6 — CID 2935713
3-(3-methoxyphenoxy)-N,N-dimethylpropan-1-amine;oxalic acid (PubChem CID 2935713) has the molecular formula C14H21NO6 and a molecular weight of 299.32 g/mol. Its IUPAC name is 3-(3-methoxyphenoxy)-N,N-dimethylpropan-1-amine;oxalic acid.
| Compound Name | 3-(3-methoxyphenoxy)-N,N-dimethylpropan-1-amine;oxalic acid |
|---|---|
| PubChem CID | 2935713 |
| Molecular Formula | C14H21NO6 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 3-(3-methoxyphenoxy)-N,N-dimethylpropan-1-amine;oxalic acid |
| SMILES | COc1cccc(OCCCN(C)C)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C12H19NO2.C2H2O4/c1-13(2)8-5-9-15-12-7-4-6-11(10-12)14-3;3-1(4)2(5)6/h4,6-7,10H,5,8-9H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | DUZMWWOTVZXWTF-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|