C11H17NO2 — CID 10081369
2-(3-methoxyphenoxy)-N,N-dimethylethanamine (PubChem CID 10081369) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is 2-(3-methoxyphenoxy)-N,N-dimethylethanamine.
| Compound Name | 2-(3-methoxyphenoxy)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 10081369 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 2-(3-methoxyphenoxy)-N,N-dimethylethanamine |
| SMILES | COc1cccc(OCCN(C)C)c1 |
| InChI | InChI=1S/C11H17NO2/c1-12(2)7-8-14-11-6-4-5-10(9-11)13-3/h4-6,9H,7-8H2,1-3H3 |
| InChIKey | ALBHGNDBXQFJOL-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |