C19H24O5S — CID 87800970
3-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]propyl methanesulfonate (PubChem CID 87800970) has the molecular formula C19H24O5S and a molecular weight of 364.46 g/mol. Its IUPAC name is 3-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]propyl methanesulfonate.
| Compound Name | 3-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]propyl methanesulfonate |
|---|---|
| PubChem CID | 87800970 |
| Molecular Formula | C19H24O5S |
| Molecular Weight | 364.46 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 3-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]propyl methanesulfonate |
| SMILES | COc1cccc(CCc2ccccc2OCCCOS(C)(=O)=O)c1 |
| InChI | InChI=1S/C19H24O5S/c1-22-18-9-5-7-16(15-18)11-12-17-8-3-4-10-19(17)23-13-6-14-24-25(2,20)21/h3-5,7-10,15H,6,11-14H2,1-2H3 |
| InChIKey | YKWCZCUWIHYNGI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|