C26H33ClN4O2 — CID 25157256
2-[4-[3-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]propyl]piperazin-1-yl]pyrimidine;hydrochloride (PubChem CID 25157256) has the molecular formula C26H33ClN4O2 and a molecular weight of 469.03 g/mol. Its IUPAC name is 2-[4-[3-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]propyl]piperazin-1-yl]pyrimidine;hydrochloride.
| Compound Name | 2-[4-[3-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]propyl]piperazin-1-yl]pyrimidine;hydrochloride |
|---|---|
| PubChem CID | 25157256 |
| Molecular Formula | C26H33ClN4O2 |
| Molecular Weight | 469.03 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | 2-[4-[3-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]propyl]piperazin-1-yl]pyrimidine;hydrochloride |
| SMILES | COc1cccc(CCc2ccccc2OCCCN2CCN(c3ncccn3)CC2)c1.Cl |
| InChI | InChI=1S/C26H32N4O2.ClH/c1-31-24-9-4-7-22(21-24)11-12-23-8-2-3-10-25(23)32-20-6-15-29-16-18-30(19-17-29)26-27-13-5-14-28-26;/h2-5,7-10,13-14,21H,6,11-12,15-20H2,1H3;1H |
| InChIKey | AJYNRGRKZKUUDT-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.03 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|