C12H18O4S — CID 19688465
3-(2-ethoxyphenyl)propyl methanesulfonate (PubChem CID 19688465) has the molecular formula C12H18O4S and a molecular weight of 258.34 g/mol. Its IUPAC name is 3-(2-ethoxyphenyl)propyl methanesulfonate.
| Compound Name | 3-(2-ethoxyphenyl)propyl methanesulfonate |
|---|---|
| PubChem CID | 19688465 |
| Molecular Formula | C12H18O4S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 3-(2-ethoxyphenyl)propyl methanesulfonate |
| SMILES | CCOc1ccccc1CCCOS(C)(=O)=O |
| InChI | InChI=1S/C12H18O4S/c1-3-15-12-9-5-4-7-11(12)8-6-10-16-17(2,13)14/h4-5,7,9H,3,6,8,10H2,1-2H3 |
| InChIKey | AWICIEGAXFMXNE-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|