About (2-hexoxyphenyl)methyl methanesulfonate
(2-hexoxyphenyl)methyl methanesulfonate (PubChem CID 90319134) has the molecular formula C14H22O4S
and a molecular weight of 286.39 g/mol. Its IUPAC name is (2-hexoxyphenyl)methyl methanesulfonate.
Molecular Properties
| Compound Name | (2-hexoxyphenyl)methyl methanesulfonate |
| PubChem CID | 90319134 |
| Molecular Formula | C14H22O4S |
| Molecular Weight | 286.39 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | (2-hexoxyphenyl)methyl methanesulfonate |
| SMILES | CCCCCCOc1ccccc1COS(C)(=O)=O |
| InChI | InChI=1S/C14H22O4S/c1-3-4-5-8-11-17-14-10-7-6-9-13(14)12-18-19(2,15)16/h6-7,9-10H,3-5,8,11-12H2,1-2H3 |
| InChIKey | PPDQRBXCGAIYOV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (2-hexoxyphenyl)methyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hexoxyphenyl)methyl methanesulfonate?
The IUPAC name of (2-hexoxyphenyl)methyl methanesulfonate (CID 90319134) is (2-hexoxyphenyl)methyl methanesulfonate.
What is the SMILES notation for (2-hexoxyphenyl)methyl methanesulfonate?
The canonical SMILES for (2-hexoxyphenyl)methyl methanesulfonate is CCCCCCOc1ccccc1COS(C)(=O)=O.
What is the InChIKey of (2-hexoxyphenyl)methyl methanesulfonate?
The InChIKey is PPDQRBXCGAIYOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O4S/c1-3-4-5-8-11-17-14-10-7-6-9-13(14)12-18-19(2,15)16/h6-7,9-10H,3-5,8,11-12H2,1-2H3.
What are the key properties of (2-hexoxyphenyl)methyl methanesulfonate?
(2-hexoxyphenyl)methyl methanesulfonate has a molecular weight of 286.39 g/mol, XLogP of 3.12, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hexoxyphenyl)methyl methanesulfonate is sourced from PubChem (CID 90319134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).