About 3-(2-bromophenyl)propyl methanesulfonate
3-(2-bromophenyl)propyl methanesulfonate (PubChem CID 15364879) has the molecular formula C10H13BrO3S
and a molecular weight of 293.18 g/mol. Its IUPAC name is 3-(2-bromophenyl)propyl methanesulfonate.
Molecular Properties
| Compound Name | 3-(2-bromophenyl)propyl methanesulfonate |
| PubChem CID | 15364879 |
| Molecular Formula | C10H13BrO3S |
| Molecular Weight | 293.18 g/mol |
| Exact Mass | 291.98 |
| IUPAC Name | 3-(2-bromophenyl)propyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCCc1ccccc1Br |
| InChI | InChI=1S/C10H13BrO3S/c1-15(12,13)14-8-4-6-9-5-2-3-7-10(9)11/h2-3,5,7H,4,6,8H2,1H3 |
| InChIKey | VYMPNASDUNFWDY-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.18 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-bromophenyl)propyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-bromophenyl)propyl methanesulfonate?
The IUPAC name of 3-(2-bromophenyl)propyl methanesulfonate (CID 15364879) is 3-(2-bromophenyl)propyl methanesulfonate.
What is the SMILES notation for 3-(2-bromophenyl)propyl methanesulfonate?
The canonical SMILES for 3-(2-bromophenyl)propyl methanesulfonate is CS(=O)(=O)OCCCc1ccccc1Br.
What is the InChIKey of 3-(2-bromophenyl)propyl methanesulfonate?
The InChIKey is VYMPNASDUNFWDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13BrO3S/c1-15(12,13)14-8-4-6-9-5-2-3-7-10(9)11/h2-3,5,7H,4,6,8H2,1H3.
What are the key properties of 3-(2-bromophenyl)propyl methanesulfonate?
3-(2-bromophenyl)propyl methanesulfonate has a molecular weight of 293.18 g/mol, XLogP of 2.36, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-bromophenyl)propyl methanesulfonate is sourced from PubChem (CID 15364879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).