C16H23BrO5S — CID 19688453
ethyl 2-[(2-bromophenyl)methyl]-6-methylsulfonyloxyhexanoate (PubChem CID 19688453) has the molecular formula C16H23BrO5S and a molecular weight of 407.33 g/mol. Its IUPAC name is ethyl 2-[(2-bromophenyl)methyl]-6-methylsulfonyloxyhexanoate.
| Compound Name | ethyl 2-[(2-bromophenyl)methyl]-6-methylsulfonyloxyhexanoate |
|---|---|
| PubChem CID | 19688453 |
| Molecular Formula | C16H23BrO5S |
| Molecular Weight | 407.33 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | ethyl 2-[(2-bromophenyl)methyl]-6-methylsulfonyloxyhexanoate |
| SMILES | CCOC(=O)C(CCCCOS(C)(=O)=O)Cc1ccccc1Br |
| InChI | InChI=1S/C16H23BrO5S/c1-3-21-16(18)14(9-6-7-11-22-23(2,19)20)12-13-8-4-5-10-15(13)17/h4-5,8,10,14H,3,6-7,9,11-12H2,1-2H3 |
| InChIKey | MWKYKWINUKLWTN-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|