C16H25NO5S — CID 10991527
methyl (2S,3R)-3-amino-8-methylsulfonyloxy-2-phenyloctanoate (PubChem CID 10991527) has the molecular formula C16H25NO5S and a molecular weight of 343.44 g/mol. Its IUPAC name is methyl (2S,3R)-3-amino-8-methylsulfonyloxy-2-phenyloctanoate.
| Compound Name | methyl (2S,3R)-3-amino-8-methylsulfonyloxy-2-phenyloctanoate |
|---|---|
| PubChem CID | 10991527 |
| Molecular Formula | C16H25NO5S |
| Molecular Weight | 343.44 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | methyl (2S,3R)-3-amino-8-methylsulfonyloxy-2-phenyloctanoate |
| SMILES | COC(=O)[C@@H](c1ccccc1)[C@H](N)CCCCCOS(C)(=O)=O |
| InChI | InChI=1S/C16H25NO5S/c1-21-16(18)15(13-9-5-3-6-10-13)14(17)11-7-4-8-12-22-23(2,19)20/h3,5-6,9-10,14-15H,4,7-8,11-12,17H2,1-2H3/t14-,15+/m1/s1 |
| InChIKey | XQKLLGPANPBXFO-CABCVRRESA-N |
| XLogP | 1.81 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.44 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|