C21H28O5S — CID 73351304
[(5S,6R)-5,6-bis(4-hydroxyphenyl)octyl] methanesulfonate (PubChem CID 73351304) has the molecular formula C21H28O5S and a molecular weight of 392.52 g/mol. Its IUPAC name is [(5S,6R)-5,6-bis(4-hydroxyphenyl)octyl] methanesulfonate.
| Compound Name | [(5S,6R)-5,6-bis(4-hydroxyphenyl)octyl] methanesulfonate |
|---|---|
| PubChem CID | 73351304 |
| Molecular Formula | C21H28O5S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | [(5S,6R)-5,6-bis(4-hydroxyphenyl)octyl] methanesulfonate |
| SMILES | CC[C@@H](c1ccc(O)cc1)[C@H](CCCCOS(C)(=O)=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C21H28O5S/c1-3-20(16-7-11-18(22)12-8-16)21(17-9-13-19(23)14-10-17)6-4-5-15-26-27(2,24)25/h7-14,20-23H,3-6,15H2,1-2H3/t20-,21+/m0/s1 |
| InChIKey | ZRTBUGVCMUXXEW-LEWJYISDSA-N |
| XLogP | 4.52 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|