C42H50O8 — CID 138753104
8-[(2R,3S)-2,3-bis(4-hydroxyphenyl)pentanoyl]oxyoctyl (2R,3S)-2,3-bis(4-hydroxyphenyl)pentanoate (PubChem CID 138753104) has the molecular formula C42H50O8 and a molecular weight of 682.85 g/mol. Its IUPAC name is 8-[(2R,3S)-2,3-bis(4-hydroxyphenyl)pentanoyl]oxyoctyl (2R,3S)-2,3-bis(4-hydroxyphenyl)pentanoate.
| Compound Name | 8-[(2R,3S)-2,3-bis(4-hydroxyphenyl)pentanoyl]oxyoctyl (2R,3S)-2,3-bis(4-hydroxyphenyl)pentanoate |
|---|---|
| PubChem CID | 138753104 |
| Molecular Formula | C42H50O8 |
| Molecular Weight | 682.85 g/mol |
| Exact Mass | 682.35 |
| IUPAC Name | 8-[(2R,3S)-2,3-bis(4-hydroxyphenyl)pentanoyl]oxyoctyl (2R,3S)-2,3-bis(4-hydroxyphenyl)pentanoate |
| SMILES | CC[C@H](c1ccc(O)cc1)[C@@H](C(=O)OCCCCCCCCOC(=O)[C@@H](c1ccc(O)cc1)[C@H](CC)c1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C42H50O8/c1-3-37(29-11-19-33(43)20-12-29)39(31-15-23-35(45)24-16-31)41(47)49-27-9-7-5-6-8-10-28-50-42(48)40(32-17-25-36(46)26-18-32)38(4-2)30-13-21-34(44)22-14-30/h11-26,37-40,43-46H,3-10,27-28H2,1-2H3/t37-,38-,39+,40+/m1/s1 |
| InChIKey | XRQONWRQMXAXHV-WESAGZJESA-N |
| XLogP | 9.19 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.85 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|