C21H28O3 — CID 177386829
octyl (2S)-2-(6-hydroxynaphthalen-2-yl)propanoate (PubChem CID 177386829) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is octyl (2S)-2-(6-hydroxynaphthalen-2-yl)propanoate.
| Compound Name | octyl (2S)-2-(6-hydroxynaphthalen-2-yl)propanoate |
|---|---|
| PubChem CID | 177386829 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | octyl (2S)-2-(6-hydroxynaphthalen-2-yl)propanoate |
| SMILES | CCCCCCCCOC(=O)[C@@H](C)c1ccc2cc(O)ccc2c1 |
| InChI | InChI=1S/C21H28O3/c1-3-4-5-6-7-8-13-24-21(23)16(2)17-9-10-19-15-20(22)12-11-18(19)14-17/h9-12,14-16,22H,3-8,13H2,1-2H3/t16-/m0/s1 |
| InChIKey | XZIXXLLXCTWHPQ-INIZCTEOSA-N |
| XLogP | 5.55 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|