C40H50O4 — CID 102327758
hexyl (2S)-2-[6-[[4-(4-octoxyphenyl)phenyl]methoxy]naphthalen-2-yl]propanoate (PubChem CID 102327758) has the molecular formula C40H50O4 and a molecular weight of 594.84 g/mol. Its IUPAC name is hexyl (2S)-2-[6-[[4-(4-octoxyphenyl)phenyl]methoxy]naphthalen-2-yl]propanoate.
| Compound Name | hexyl (2S)-2-[6-[[4-(4-octoxyphenyl)phenyl]methoxy]naphthalen-2-yl]propanoate |
|---|---|
| PubChem CID | 102327758 |
| Molecular Formula | C40H50O4 |
| Molecular Weight | 594.84 g/mol |
| Exact Mass | 594.37 |
| IUPAC Name | hexyl (2S)-2-[6-[[4-(4-octoxyphenyl)phenyl]methoxy]naphthalen-2-yl]propanoate |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(COc3ccc4cc([C@H](C)C(=O)OCCCCCC)ccc4c3)cc2)cc1 |
| InChI | InChI=1S/C40H50O4/c1-4-6-8-10-11-13-26-42-38-23-20-34(21-24-38)33-16-14-32(15-17-33)30-44-39-25-22-36-28-35(18-19-37(36)29-39)31(3)40(41)43-27-12-9-7-5-2/h14-25,28-29,31H,4-13,26-27,30H2,1-3H3/t31-/m0/s1 |
| InChIKey | OFDVHVNOFCAPMX-HKBQPEDESA-N |
| XLogP | 11.05 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.84 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|