C38H52O5 — CID 177486550
[6-[(2S)-1-octoxy-1-oxopropan-2-yl]naphthalen-2-yl] 4-decoxybenzoate (PubChem CID 177486550) has the molecular formula C38H52O5 and a molecular weight of 588.83 g/mol. Its IUPAC name is [6-[(2S)-1-octoxy-1-oxopropan-2-yl]naphthalen-2-yl] 4-decoxybenzoate.
| Compound Name | [6-[(2S)-1-octoxy-1-oxopropan-2-yl]naphthalen-2-yl] 4-decoxybenzoate |
|---|---|
| PubChem CID | 177486550 |
| Molecular Formula | C38H52O5 |
| Molecular Weight | 588.83 g/mol |
| Exact Mass | 588.38 |
| IUPAC Name | [6-[(2S)-1-octoxy-1-oxopropan-2-yl]naphthalen-2-yl] 4-decoxybenzoate |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)Oc2ccc3cc([C@H](C)C(=O)OCCCCCCCC)ccc3c2)cc1 |
| InChI | InChI=1S/C38H52O5/c1-4-6-8-10-12-13-15-16-26-41-35-23-20-31(21-24-35)38(40)43-36-25-22-33-28-32(18-19-34(33)29-36)30(3)37(39)42-27-17-14-11-9-7-5-2/h18-25,28-30H,4-17,26-27H2,1-3H3/t30-/m0/s1 |
| InChIKey | NJGKLNDBUJUCEA-PMERELPUSA-N |
| XLogP | 10.59 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.83 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|