C36H48O5 — CID 177438413
[6-[(2S)-1-hexoxy-1-oxopropan-2-yl]naphthalen-2-yl] 4-decoxybenzoate (PubChem CID 177438413) has the molecular formula C36H48O5 and a molecular weight of 560.78 g/mol. Its IUPAC name is [6-[(2S)-1-hexoxy-1-oxopropan-2-yl]naphthalen-2-yl] 4-decoxybenzoate.
| Compound Name | [6-[(2S)-1-hexoxy-1-oxopropan-2-yl]naphthalen-2-yl] 4-decoxybenzoate |
|---|---|
| PubChem CID | 177438413 |
| Molecular Formula | C36H48O5 |
| Molecular Weight | 560.78 g/mol |
| Exact Mass | 560.35 |
| IUPAC Name | [6-[(2S)-1-hexoxy-1-oxopropan-2-yl]naphthalen-2-yl] 4-decoxybenzoate |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)Oc2ccc3cc([C@H](C)C(=O)OCCCCCC)ccc3c2)cc1 |
| InChI | InChI=1S/C36H48O5/c1-4-6-8-10-11-12-13-15-24-39-33-21-18-29(19-22-33)36(38)41-34-23-20-31-26-30(16-17-32(31)27-34)28(3)35(37)40-25-14-9-7-5-2/h16-23,26-28H,4-15,24-25H2,1-3H3/t28-/m0/s1 |
| InChIKey | IYZREMSRNGLHNI-NDEPHWFRSA-N |
| XLogP | 9.81 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.78 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|