C20H23F3O2 — CID 21412581
hexyl 2-[6-(trifluoromethyl)naphthalen-2-yl]propanoate (PubChem CID 21412581) has the molecular formula C20H23F3O2 and a molecular weight of 352.40 g/mol. Its IUPAC name is hexyl 2-[6-(trifluoromethyl)naphthalen-2-yl]propanoate.
| Compound Name | hexyl 2-[6-(trifluoromethyl)naphthalen-2-yl]propanoate |
|---|---|
| PubChem CID | 21412581 |
| Molecular Formula | C20H23F3O2 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | hexyl 2-[6-(trifluoromethyl)naphthalen-2-yl]propanoate |
| SMILES | CCCCCCOC(=O)C(C)c1ccc2cc(C(F)(F)F)ccc2c1 |
| InChI | InChI=1S/C20H23F3O2/c1-3-4-5-6-11-25-19(24)14(2)15-7-8-17-13-18(20(21,22)23)10-9-16(17)12-15/h7-10,12-14H,3-6,11H2,1-2H3 |
| InChIKey | YFQQYRYWZJRQCC-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|