C17H18O4 — CID 12962939
(2R,3S)-2,3-bis(4-hydroxyphenyl)pentanoic acid (PubChem CID 12962939) has the molecular formula C17H18O4 and a molecular weight of 286.33 g/mol. Its IUPAC name is (2R,3S)-2,3-bis(4-hydroxyphenyl)pentanoic acid.
| Compound Name | (2R,3S)-2,3-bis(4-hydroxyphenyl)pentanoic acid |
|---|---|
| PubChem CID | 12962939 |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | (2R,3S)-2,3-bis(4-hydroxyphenyl)pentanoic acid |
| SMILES | CC[C@H](c1ccc(O)cc1)[C@@H](C(=O)O)c1ccc(O)cc1 |
| InChI | InChI=1S/C17H18O4/c1-2-15(11-3-7-13(18)8-4-11)16(17(20)21)12-5-9-14(19)10-6-12/h3-10,15-16,18-19H,2H2,1H3,(H,20,21)/t15-,16+/m1/s1 |
| InChIKey | YSQRGPRONAPBRA-CVEARBPZSA-N |
| XLogP | 3.46 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |