About butyl 2-ethyl-4-(4-hydroxyphenyl)pentanoate;methane
butyl 2-ethyl-4-(4-hydroxyphenyl)pentanoate;methane (PubChem CID 159769667) has the molecular formula C20H38O3
and a molecular weight of 326.52 g/mol. Its IUPAC name is butyl 2-ethyl-4-(4-hydroxyphenyl)pentanoate;methane.
Molecular Properties
| Compound Name | butyl 2-ethyl-4-(4-hydroxyphenyl)pentanoate;methane |
| PubChem CID | 159769667 |
| Molecular Formula | C20H38O3 |
| Molecular Weight | 326.52 g/mol |
| Exact Mass | 326.28 |
| IUPAC Name | butyl 2-ethyl-4-(4-hydroxyphenyl)pentanoate;methane |
| SMILES | C.C.C.CCCCOC(=O)C(CC)CC(C)c1ccc(O)cc1 |
| InChI | InChI=1S/C17H26O3.3CH4/c1-4-6-11-20-17(19)14(5-2)12-13(3)15-7-9-16(18)10-8-15;;;/h7-10,13-14,18H,4-6,11-12H2,1-3H3;3*1H4 |
| InChIKey | NFYMGBMVHNBVFD-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.52 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 2-ethyl-4-(4-hydroxyphenyl)pentanoate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 2-ethyl-4-(4-hydroxyphenyl)pentanoate;methane?
The IUPAC name of butyl 2-ethyl-4-(4-hydroxyphenyl)pentanoate;methane (CID 159769667) is butyl 2-ethyl-4-(4-hydroxyphenyl)pentanoate;methane.
What is the SMILES notation for butyl 2-ethyl-4-(4-hydroxyphenyl)pentanoate;methane?
The canonical SMILES for butyl 2-ethyl-4-(4-hydroxyphenyl)pentanoate;methane is C.C.C.CCCCOC(=O)C(CC)CC(C)c1ccc(O)cc1.
What is the InChIKey of butyl 2-ethyl-4-(4-hydroxyphenyl)pentanoate;methane?
The InChIKey is NFYMGBMVHNBVFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26O3.3CH4/c1-4-6-11-20-17(19)14(5-2)12-13(3)15-7-9-16(18)10-8-15;;;/h7-10,13-14,18H,4-6,11-12H2,1-3H3;3*1H4.
What are the key properties of butyl 2-ethyl-4-(4-hydroxyphenyl)pentanoate;methane?
butyl 2-ethyl-4-(4-hydroxyphenyl)pentanoate;methane has a molecular weight of 326.52 g/mol, XLogP of 6.16, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 2-ethyl-4-(4-hydroxyphenyl)pentanoate;methane is sourced from PubChem (CID 159769667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).