C31H46O5 — CID 156673787
tert-butyl 6-[4-(1-butoxyethoxy)phenyl]-2-ethyl-4-(4-hydroxyphenyl)heptanoate (PubChem CID 156673787) has the molecular formula C31H46O5 and a molecular weight of 498.70 g/mol. Its IUPAC name is tert-butyl 6-[4-(1-butoxyethoxy)phenyl]-2-ethyl-4-(4-hydroxyphenyl)heptanoate.
| Compound Name | tert-butyl 6-[4-(1-butoxyethoxy)phenyl]-2-ethyl-4-(4-hydroxyphenyl)heptanoate |
|---|---|
| PubChem CID | 156673787 |
| Molecular Formula | C31H46O5 |
| Molecular Weight | 498.70 g/mol |
| Exact Mass | 498.33 |
| IUPAC Name | tert-butyl 6-[4-(1-butoxyethoxy)phenyl]-2-ethyl-4-(4-hydroxyphenyl)heptanoate |
| SMILES | CCCCOC(C)Oc1ccc(C(C)CC(CC(CC)C(=O)OC(C)(C)C)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C31H46O5/c1-8-10-19-34-23(4)35-29-17-13-25(14-18-29)22(3)20-27(26-11-15-28(32)16-12-26)21-24(9-2)30(33)36-31(5,6)7/h11-18,22-24,27,32H,8-10,19-21H2,1-7H3 |
| InChIKey | IPUPNGQVTITPBS-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.70 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|