C33H44O5 — CID 54358686
4-[4-[4-(1-hydroxyethoxy)phenyl]-6-[4-(1-propoxyethoxy)phenyl]octan-2-yl]phenol (PubChem CID 54358686) has the molecular formula C33H44O5 and a molecular weight of 520.71 g/mol. Its IUPAC name is 4-[4-[4-(1-hydroxyethoxy)phenyl]-6-[4-(1-propoxyethoxy)phenyl]octan-2-yl]phenol.
| Compound Name | 4-[4-[4-(1-hydroxyethoxy)phenyl]-6-[4-(1-propoxyethoxy)phenyl]octan-2-yl]phenol |
|---|---|
| PubChem CID | 54358686 |
| Molecular Formula | C33H44O5 |
| Molecular Weight | 520.71 g/mol |
| Exact Mass | 520.32 |
| IUPAC Name | 4-[4-[4-(1-hydroxyethoxy)phenyl]-6-[4-(1-propoxyethoxy)phenyl]octan-2-yl]phenol |
| SMILES | CCCOC(C)Oc1ccc(C(CC)CC(CC(C)c2ccc(O)cc2)c2ccc(OC(C)O)cc2)cc1 |
| InChI | InChI=1S/C33H44O5/c1-6-20-36-25(5)38-33-18-10-28(11-19-33)26(7-2)22-30(21-23(3)27-8-14-31(35)15-9-27)29-12-16-32(17-13-29)37-24(4)34/h8-19,23-26,30,34-35H,6-7,20-22H2,1-5H3 |
| InChIKey | UKXYNJMHDNRLNJ-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.71 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|