C35H50O5Si — CID 59058324
4-[4-[4-(1-methoxyethoxy)phenyl]-6-[4-[1-(trimethylsilylmethoxy)ethoxy]phenyl]octan-2-yl]phenol (PubChem CID 59058324) has the molecular formula C35H50O5Si and a molecular weight of 578.87 g/mol. Its IUPAC name is 4-[4-[4-(1-methoxyethoxy)phenyl]-6-[4-[1-(trimethylsilylmethoxy)ethoxy]phenyl]octan-2-yl]phenol.
| Compound Name | 4-[4-[4-(1-methoxyethoxy)phenyl]-6-[4-[1-(trimethylsilylmethoxy)ethoxy]phenyl]octan-2-yl]phenol |
|---|---|
| PubChem CID | 59058324 |
| Molecular Formula | C35H50O5Si |
| Molecular Weight | 578.87 g/mol |
| Exact Mass | 578.34 |
| IUPAC Name | 4-[4-[4-(1-methoxyethoxy)phenyl]-6-[4-[1-(trimethylsilylmethoxy)ethoxy]phenyl]octan-2-yl]phenol |
| SMILES | CCC(CC(CC(C)c1ccc(O)cc1)c1ccc(OC(C)OC)cc1)c1ccc(OC(C)OC[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C35H50O5Si/c1-9-28(30-12-18-35(19-13-30)40-27(4)38-24-41(6,7)8)23-32(22-25(2)29-10-16-33(36)17-11-29)31-14-20-34(21-15-31)39-26(3)37-5/h10-21,25-28,32,36H,9,22-24H2,1-8H3 |
| InChIKey | IVODWAPIGQSPDY-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.87 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|