C26H32N2O3 — CID 20725431
2-[3-[4-(1-ethoxyethoxy)phenyl]-1-(4-hydroxyphenyl)pentyl]-3-methylbutanedinitrile (PubChem CID 20725431) has the molecular formula C26H32N2O3 and a molecular weight of 420.55 g/mol. Its IUPAC name is 2-[3-[4-(1-ethoxyethoxy)phenyl]-1-(4-hydroxyphenyl)pentyl]-3-methylbutanedinitrile.
| Compound Name | 2-[3-[4-(1-ethoxyethoxy)phenyl]-1-(4-hydroxyphenyl)pentyl]-3-methylbutanedinitrile |
|---|---|
| PubChem CID | 20725431 |
| Molecular Formula | C26H32N2O3 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | 2-[3-[4-(1-ethoxyethoxy)phenyl]-1-(4-hydroxyphenyl)pentyl]-3-methylbutanedinitrile |
| SMILES | CCOC(C)Oc1ccc(C(CC)CC(c2ccc(O)cc2)C(C#N)C(C)C#N)cc1 |
| InChI | InChI=1S/C26H32N2O3/c1-5-20(21-9-13-24(14-10-21)31-19(4)30-6-2)15-25(26(17-28)18(3)16-27)22-7-11-23(29)12-8-22/h7-14,18-20,25-26,29H,5-6,15H2,1-4H3 |
| InChIKey | BUYQGVZLNOYRNM-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|