C48H58O8 — CID 90276539
1,4-bis[bis[4-(1-ethoxyethoxy)phenyl]methyl]benzene (PubChem CID 90276539) has the molecular formula C48H58O8 and a molecular weight of 762.98 g/mol. Its IUPAC name is 1,4-bis[bis[4-(1-ethoxyethoxy)phenyl]methyl]benzene.
| Compound Name | 1,4-bis[bis[4-(1-ethoxyethoxy)phenyl]methyl]benzene |
|---|---|
| PubChem CID | 90276539 |
| Molecular Formula | C48H58O8 |
| Molecular Weight | 762.98 g/mol |
| Exact Mass | 762.41 |
| IUPAC Name | 1,4-bis[bis[4-(1-ethoxyethoxy)phenyl]methyl]benzene |
| SMILES | CCOC(C)Oc1ccc(C(c2ccc(OC(C)OCC)cc2)c2ccc(C(c3ccc(OC(C)OCC)cc3)c3ccc(OC(C)OCC)cc3)cc2)cc1 |
| InChI | InChI=1S/C48H58O8/c1-9-49-33(5)53-43-25-17-39(18-26-43)47(40-19-27-44(28-20-40)54-34(6)50-10-2)37-13-15-38(16-14-37)48(41-21-29-45(30-22-41)55-35(7)51-11-3)42-23-31-46(32-24-42)56-36(8)52-12-4/h13-36,47-48H,9-12H2,1-8H3 |
| InChIKey | NJTXOCLFWBJCOG-UHFFFAOYSA-N |
| XLogP | 11.09 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.98 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|