C27H38O7 — CID 54137263
tert-butyl 3,3-bis[4-(1-ethoxyethoxy)phenyl]-2-hydroxypropanoate (PubChem CID 54137263) has the molecular formula C27H38O7 and a molecular weight of 474.59 g/mol. Its IUPAC name is tert-butyl 3,3-bis[4-(1-ethoxyethoxy)phenyl]-2-hydroxypropanoate.
| Compound Name | tert-butyl 3,3-bis[4-(1-ethoxyethoxy)phenyl]-2-hydroxypropanoate |
|---|---|
| PubChem CID | 54137263 |
| Molecular Formula | C27H38O7 |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | tert-butyl 3,3-bis[4-(1-ethoxyethoxy)phenyl]-2-hydroxypropanoate |
| SMILES | CCOC(C)Oc1ccc(C(c2ccc(OC(C)OCC)cc2)C(O)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C27H38O7/c1-8-30-18(3)32-22-14-10-20(11-15-22)24(25(28)26(29)34-27(5,6)7)21-12-16-23(17-13-21)33-19(4)31-9-2/h10-19,24-25,28H,8-9H2,1-7H3 |
| InChIKey | NYPGYWRBFCECCA-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|