C28H36O5 — CID 87583156
tert-butyl 2-methylprop-2-enoate;4-[4-[4-(1-ethoxyethoxy)phenyl]buta-1,3-dienyl]phenol (PubChem CID 87583156) has the molecular formula C28H36O5 and a molecular weight of 452.59 g/mol. Its IUPAC name is tert-butyl 2-methylprop-2-enoate;4-[4-[4-(1-ethoxyethoxy)phenyl]buta-1,3-dienyl]phenol.
| Compound Name | tert-butyl 2-methylprop-2-enoate;4-[4-[4-(1-ethoxyethoxy)phenyl]buta-1,3-dienyl]phenol |
|---|---|
| PubChem CID | 87583156 |
| Molecular Formula | C28H36O5 |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | tert-butyl 2-methylprop-2-enoate;4-[4-[4-(1-ethoxyethoxy)phenyl]buta-1,3-dienyl]phenol |
| SMILES | C=C(C)C(=O)OC(C)(C)C.CCOC(C)Oc1ccc(C=CC=Cc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C20H22O3.C8H14O2/c1-3-22-16(2)23-20-14-10-18(11-15-20)7-5-4-6-17-8-12-19(21)13-9-17;1-6(2)7(9)10-8(3,4)5/h4-16,21H,3H2,1-2H3;1H2,2-5H3 |
| InChIKey | SIAXXVWNEFQTQX-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|