C21H24O3 — CID 87756596
4-[4-[4-(1-ethoxypropoxy)phenyl]buta-1,3-dienyl]phenol (PubChem CID 87756596) has the molecular formula C21H24O3 and a molecular weight of 324.42 g/mol. Its IUPAC name is 4-[4-[4-(1-ethoxypropoxy)phenyl]buta-1,3-dienyl]phenol.
| Compound Name | 4-[4-[4-(1-ethoxypropoxy)phenyl]buta-1,3-dienyl]phenol |
|---|---|
| PubChem CID | 87756596 |
| Molecular Formula | C21H24O3 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 4-[4-[4-(1-ethoxypropoxy)phenyl]buta-1,3-dienyl]phenol |
| SMILES | CCOC(CC)Oc1ccc(C=CC=Cc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C21H24O3/c1-3-21(23-4-2)24-20-15-11-18(12-16-20)8-6-5-7-17-9-13-19(22)14-10-17/h5-16,21-22H,3-4H2,1-2H3 |
| InChIKey | NYCTYBFAWYIQHV-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|