C36H54O3 — CID 91131838
1-butan-2-yl-4-(1-ethoxypropoxy)benzene;1-butan-2-yl-4-methylbenzene;4-butan-2-ylphenol (PubChem CID 91131838) has the molecular formula C36H54O3 and a molecular weight of 534.83 g/mol. Its IUPAC name is 1-butan-2-yl-4-(1-ethoxypropoxy)benzene;1-butan-2-yl-4-methylbenzene;4-butan-2-ylphenol.
| Compound Name | 1-butan-2-yl-4-(1-ethoxypropoxy)benzene;1-butan-2-yl-4-methylbenzene;4-butan-2-ylphenol |
|---|---|
| PubChem CID | 91131838 |
| Molecular Formula | C36H54O3 |
| Molecular Weight | 534.83 g/mol |
| Exact Mass | 534.41 |
| IUPAC Name | 1-butan-2-yl-4-(1-ethoxypropoxy)benzene;1-butan-2-yl-4-methylbenzene;4-butan-2-ylphenol |
| SMILES | CCC(C)c1ccc(C)cc1.CCC(C)c1ccc(O)cc1.CCOC(CC)Oc1ccc(C(C)CC)cc1 |
| InChI | InChI=1S/C15H24O2.C11H16.C10H14O/c1-5-12(4)13-8-10-14(11-9-13)17-15(6-2)16-7-3;1-4-10(3)11-7-5-9(2)6-8-11;1-3-8(2)9-4-6-10(11)7-5-9/h8-12,15H,5-7H2,1-4H3;5-8,10H,4H2,1-3H3;4-8,11H,3H2,1-2H3 |
| InChIKey | ZBLUKJXXVSFEQS-UHFFFAOYSA-N |
| XLogP | 10.77 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.83 |
| LogP ≤ 5 | 10.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|