C36H52O6 — CID 91394144
1-butan-2-yl-4-(1-ethoxyethoxy)benzene;4-butan-2-ylphenol;(4-butan-2-ylphenyl) methyl carbonate (PubChem CID 91394144) has the molecular formula C36H52O6 and a molecular weight of 580.81 g/mol. Its IUPAC name is 1-butan-2-yl-4-(1-ethoxyethoxy)benzene;4-butan-2-ylphenol;(4-butan-2-ylphenyl) methyl carbonate.
| Compound Name | 1-butan-2-yl-4-(1-ethoxyethoxy)benzene;4-butan-2-ylphenol;(4-butan-2-ylphenyl) methyl carbonate |
|---|---|
| PubChem CID | 91394144 |
| Molecular Formula | C36H52O6 |
| Molecular Weight | 580.81 g/mol |
| Exact Mass | 580.38 |
| IUPAC Name | 1-butan-2-yl-4-(1-ethoxyethoxy)benzene;4-butan-2-ylphenol;(4-butan-2-ylphenyl) methyl carbonate |
| SMILES | CCC(C)c1ccc(O)cc1.CCC(C)c1ccc(OC(=O)OC)cc1.CCOC(C)Oc1ccc(C(C)CC)cc1 |
| InChI | InChI=1S/C14H22O2.C12H16O3.C10H14O/c1-5-11(3)13-7-9-14(10-8-13)16-12(4)15-6-2;1-4-9(2)10-5-7-11(8-6-10)15-12(13)14-3;1-3-8(2)9-4-6-10(11)7-5-9/h7-12H,5-6H2,1-4H3;5-9H,4H2,1-3H3;4-8,11H,3H2,1-2H3 |
| InChIKey | IRSMXNBOPQREGI-UHFFFAOYSA-N |
| XLogP | 10.21 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.81 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|