C29H46O4 — CID 123587684
2-adamantyl 2-methylbutanoate;1-butan-2-yl-4-(1-ethoxyethoxy)benzene (PubChem CID 123587684) has the molecular formula C29H46O4 and a molecular weight of 458.68 g/mol. Its IUPAC name is 2-adamantyl 2-methylbutanoate;1-butan-2-yl-4-(1-ethoxyethoxy)benzene.
| Compound Name | 2-adamantyl 2-methylbutanoate;1-butan-2-yl-4-(1-ethoxyethoxy)benzene |
|---|---|
| PubChem CID | 123587684 |
| Molecular Formula | C29H46O4 |
| Molecular Weight | 458.68 g/mol |
| Exact Mass | 458.34 |
| IUPAC Name | 2-adamantyl 2-methylbutanoate;1-butan-2-yl-4-(1-ethoxyethoxy)benzene |
| SMILES | CCC(C)C(=O)OC1C2CC3CC(C2)CC1C3.CCOC(C)Oc1ccc(C(C)CC)cc1 |
| InChI | InChI=1S/C15H24O2.C14H22O2/c1-3-9(2)15(16)17-14-12-5-10-4-11(7-12)8-13(14)6-10;1-5-11(3)13-7-9-14(10-8-13)16-12(4)15-6-2/h9-14H,3-8H2,1-2H3;7-12H,5-6H2,1-4H3 |
| InChIKey | SAMAZEGAJAWANH-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.68 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|