C23H34O2 — CID 89398620
1-[(4-butan-2-ylphenoxy)-ethoxymethyl]adamantane (PubChem CID 89398620) has the molecular formula C23H34O2 and a molecular weight of 342.52 g/mol. Its IUPAC name is 1-[(4-butan-2-ylphenoxy)-ethoxymethyl]adamantane.
| Compound Name | 1-[(4-butan-2-ylphenoxy)-ethoxymethyl]adamantane |
|---|---|
| PubChem CID | 89398620 |
| Molecular Formula | C23H34O2 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | 1-[(4-butan-2-ylphenoxy)-ethoxymethyl]adamantane |
| SMILES | CCOC(Oc1ccc(C(C)CC)cc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H34O2/c1-4-16(3)20-6-8-21(9-7-20)25-22(24-5-2)23-13-17-10-18(14-23)12-19(11-17)15-23/h6-9,16-19,22H,4-5,10-15H2,1-3H3 |
| InChIKey | UPVUFYRYRZHVNM-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|