C39H58O3 — CID 159180214
4-butan-2-ylphenol;1-[(4-butan-2-ylphenoxy)-(2-cyclohexylethoxy)methyl]adamantane (PubChem CID 159180214) has the molecular formula C39H58O3 and a molecular weight of 574.89 g/mol. Its IUPAC name is 4-butan-2-ylphenol;1-[(4-butan-2-ylphenoxy)-(2-cyclohexylethoxy)methyl]adamantane.
| Compound Name | 4-butan-2-ylphenol;1-[(4-butan-2-ylphenoxy)-(2-cyclohexylethoxy)methyl]adamantane |
|---|---|
| PubChem CID | 159180214 |
| Molecular Formula | C39H58O3 |
| Molecular Weight | 574.89 g/mol |
| Exact Mass | 574.44 |
| IUPAC Name | 4-butan-2-ylphenol;1-[(4-butan-2-ylphenoxy)-(2-cyclohexylethoxy)methyl]adamantane |
| SMILES | CCC(C)c1ccc(O)cc1.CCC(C)c1ccc(OC(OCCC2CCCCC2)C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C29H44O2.C10H14O/c1-3-21(2)26-9-11-27(12-10-26)31-28(30-14-13-22-7-5-4-6-8-22)29-18-23-15-24(19-29)17-25(16-23)20-29;1-3-8(2)9-4-6-10(11)7-5-9/h9-12,21-25,28H,3-8,13-20H2,1-2H3;4-8,11H,3H2,1-2H3 |
| InChIKey | KMUFFGBIWALQHF-UHFFFAOYSA-N |
| XLogP | 11.01 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.89 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|