C19H30O3 — CID 59460177
(3-butan-2-ylphenoxy)-(2-cyclohexylethoxy)methanol (PubChem CID 59460177) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is (3-butan-2-ylphenoxy)-(2-cyclohexylethoxy)methanol.
| Compound Name | (3-butan-2-ylphenoxy)-(2-cyclohexylethoxy)methanol |
|---|---|
| PubChem CID | 59460177 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | (3-butan-2-ylphenoxy)-(2-cyclohexylethoxy)methanol |
| SMILES | CCC(C)c1cccc(OC(O)OCCC2CCCCC2)c1 |
| InChI | InChI=1S/C19H30O3/c1-3-15(2)17-10-7-11-18(14-17)22-19(20)21-13-12-16-8-5-4-6-9-16/h7,10-11,14-16,19-20H,3-6,8-9,12-13H2,1-2H3 |
| InChIKey | PHXXIERGKPSXMM-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|