C16H24O2 — CID 58097643
1-[3-(cyclohexylmethoxy)phenyl]propan-1-ol (PubChem CID 58097643) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is 1-[3-(cyclohexylmethoxy)phenyl]propan-1-ol.
| Compound Name | 1-[3-(cyclohexylmethoxy)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 58097643 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 1-[3-(cyclohexylmethoxy)phenyl]propan-1-ol |
| SMILES | CCC(O)c1cccc(OCC2CCCCC2)c1 |
| InChI | InChI=1S/C16H24O2/c1-2-16(17)14-9-6-10-15(11-14)18-12-13-7-4-3-5-8-13/h6,9-11,13,16-17H,2-5,7-8,12H2,1H3 |
| InChIKey | VELZLRVQVWWSAU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |