C18H31NO2 — CID 143785909
(1R)-3-amino-1-[3-(cyclohexylmethoxy)phenyl]propan-1-ol;ethane (PubChem CID 143785909) has the molecular formula C18H31NO2 and a molecular weight of 293.45 g/mol. Its IUPAC name is (1R)-3-amino-1-[3-(cyclohexylmethoxy)phenyl]propan-1-ol;ethane.
| Compound Name | (1R)-3-amino-1-[3-(cyclohexylmethoxy)phenyl]propan-1-ol;ethane |
|---|---|
| PubChem CID | 143785909 |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.24 |
| IUPAC Name | (1R)-3-amino-1-[3-(cyclohexylmethoxy)phenyl]propan-1-ol;ethane |
| SMILES | CC.NCC[C@@H](O)c1cccc(OCC2CCCCC2)c1 |
| InChI | InChI=1S/C16H25NO2.C2H6/c17-10-9-16(18)14-7-4-8-15(11-14)19-12-13-5-2-1-3-6-13;1-2/h4,7-8,11,13,16,18H,1-3,5-6,9-10,12,17H2;1-2H3/t16-;/m1./s1 |
| InChIKey | HABURLNPZSPDNG-PKLMIRHRSA-N |
| XLogP | 4.05 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |