C17H28N2O2 — CID 130347435
(1S,2R)-2,3-diamino-1-[3-(cycloheptylmethoxy)phenyl]propan-1-ol (PubChem CID 130347435) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is (1S,2R)-2,3-diamino-1-[3-(cycloheptylmethoxy)phenyl]propan-1-ol.
| Compound Name | (1S,2R)-2,3-diamino-1-[3-(cycloheptylmethoxy)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 130347435 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | (1S,2R)-2,3-diamino-1-[3-(cycloheptylmethoxy)phenyl]propan-1-ol |
| SMILES | NC[C@@H](N)[C@@H](O)c1cccc(OCC2CCCCCC2)c1 |
| InChI | InChI=1S/C17H28N2O2/c18-11-16(19)17(20)14-8-5-9-15(10-14)21-12-13-6-3-1-2-4-7-13/h5,8-10,13,16-17,20H,1-4,6-7,11-12,18-19H2/t16-,17+/m1/s1 |
| InChIKey | UDBRSOLLXYPTBZ-SJORKVTESA-N |
| XLogP | 2.36 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |