C16H25NO3 — CID 58027593
(1S,2S)-3-amino-1-[3-(cyclohexylmethoxy)phenyl]propane-1,2-diol (PubChem CID 58027593) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is (1S,2S)-3-amino-1-[3-(cyclohexylmethoxy)phenyl]propane-1,2-diol.
| Compound Name | (1S,2S)-3-amino-1-[3-(cyclohexylmethoxy)phenyl]propane-1,2-diol |
|---|---|
| PubChem CID | 58027593 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | (1S,2S)-3-amino-1-[3-(cyclohexylmethoxy)phenyl]propane-1,2-diol |
| SMILES | NC[C@H](O)[C@@H](O)c1cccc(OCC2CCCCC2)c1 |
| InChI | InChI=1S/C16H25NO3/c17-10-15(18)16(19)13-7-4-8-14(9-13)20-11-12-5-2-1-3-6-12/h4,7-9,12,15-16,18-19H,1-3,5-6,10-11,17H2/t15-,16-/m0/s1 |
| InChIKey | SOEYVCWIGWTSCS-HOTGVXAUSA-N |
| XLogP | 2.00 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |