C19H31NO2 — CID 174358586
(1R,2R)-2-(aminomethyl)-1-[3-(cyclohexylmethoxy)phenyl]pentan-1-ol (PubChem CID 174358586) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is (1R,2R)-2-(aminomethyl)-1-[3-(cyclohexylmethoxy)phenyl]pentan-1-ol.
| Compound Name | (1R,2R)-2-(aminomethyl)-1-[3-(cyclohexylmethoxy)phenyl]pentan-1-ol |
|---|---|
| PubChem CID | 174358586 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | (1R,2R)-2-(aminomethyl)-1-[3-(cyclohexylmethoxy)phenyl]pentan-1-ol |
| SMILES | CCC[C@H](CN)[C@@H](O)c1cccc(OCC2CCCCC2)c1 |
| InChI | InChI=1S/C19H31NO2/c1-2-7-17(13-20)19(21)16-10-6-11-18(12-16)22-14-15-8-4-3-5-9-15/h6,10-12,15,17,19,21H,2-5,7-9,13-14,20H2,1H3/t17-,19+/m1/s1 |
| InChIKey | HGTOIXSBZOGEBZ-MJGOQNOKSA-N |
| XLogP | 4.05 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |