C17H25B2NO3 — CID 172583865
CID 172583865 (PubChem CID 172583865) has the molecular formula C17H25B2NO3 and a molecular weight of 313.01 g/mol.
| Compound Name | CID 172583865 |
|---|---|
| PubChem CID | 172583865 |
| Molecular Formula | C17H25B2NO3 |
| Molecular Weight | 313.01 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | — |
| SMILES | [B]C([B])(O)NCCC(O)c1cccc(OCC2CCCCC2)c1 |
| InChI | InChI=1S/C17H25B2NO3/c18-17(19,22)20-10-9-16(21)14-7-4-8-15(11-14)23-12-13-5-2-1-3-6-13/h4,7-8,11,13,16,20-22H,1-3,5-6,9-10,12H2 |
| InChIKey | RQYBNSDZHGQIJV-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.01 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|