C18H27B2NO6 — CID 172583864
CID 172583864 (PubChem CID 172583864) has the molecular formula C18H27B2NO6 and a molecular weight of 375.04 g/mol.
| Compound Name | CID 172583864 |
|---|---|
| PubChem CID | 172583864 |
| Molecular Formula | C18H27B2NO6 |
| Molecular Weight | 375.04 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | — |
| SMILES | [B]C([B])(O)N(CCC(O)c1cccc(OCC2CCCCC2)c1)C(O)(O)O |
| InChI | InChI=1S/C18H27B2NO6/c19-17(20,23)21(18(24,25)26)10-9-16(22)14-7-4-8-15(11-14)27-12-13-5-2-1-3-6-13/h4,7-8,11,13,16,22-26H,1-3,5-6,9-10,12H2 |
| InChIKey | ZOSOTOGKVCWVCT-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 113.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.04 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|