C18H21F8NO2 — CID 172583895
3-[bis(trifluoromethyl)amino]-1-[3-[(4,4-difluorocyclohexyl)methoxy]phenyl]propan-1-ol (PubChem CID 172583895) has the molecular formula C18H21F8NO2 and a molecular weight of 435.36 g/mol. Its IUPAC name is 3-[bis(trifluoromethyl)amino]-1-[3-[(4,4-difluorocyclohexyl)methoxy]phenyl]propan-1-ol.
| Compound Name | 3-[bis(trifluoromethyl)amino]-1-[3-[(4,4-difluorocyclohexyl)methoxy]phenyl]propan-1-ol |
|---|---|
| PubChem CID | 172583895 |
| Molecular Formula | C18H21F8NO2 |
| Molecular Weight | 435.36 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 3-[bis(trifluoromethyl)amino]-1-[3-[(4,4-difluorocyclohexyl)methoxy]phenyl]propan-1-ol |
| SMILES | OC(CCN(C(F)(F)F)C(F)(F)F)c1cccc(OCC2CCC(F)(F)CC2)c1 |
| InChI | InChI=1S/C18H21F8NO2/c19-16(20)7-4-12(5-8-16)11-29-14-3-1-2-13(10-14)15(28)6-9-27(17(21,22)23)18(24,25)26/h1-3,10,12,15,28H,4-9,11H2 |
| InChIKey | XQPNSSXAWRYDQY-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.36 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|