C16H24O2 — CID 69097479
(2S)-1-[3-(cyclopentylmethoxy)phenyl]butan-2-ol (PubChem CID 69097479) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is (2S)-1-[3-(cyclopentylmethoxy)phenyl]butan-2-ol.
| Compound Name | (2S)-1-[3-(cyclopentylmethoxy)phenyl]butan-2-ol |
|---|---|
| PubChem CID | 69097479 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (2S)-1-[3-(cyclopentylmethoxy)phenyl]butan-2-ol |
| SMILES | CC[C@H](O)Cc1cccc(OCC2CCCC2)c1 |
| InChI | InChI=1S/C16H24O2/c1-2-15(17)10-14-8-5-9-16(11-14)18-12-13-6-3-4-7-13/h5,8-9,11,13,15,17H,2-4,6-7,10,12H2,1H3/t15-/m0/s1 |
| InChIKey | UKPJYQKETCUDSJ-HNNXBMFYSA-N |
| XLogP | 3.57 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |